Citric Acid
eMolecules 2377643-37-1 | 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methylbenzoic acid | Synthonix248.238 | C12H12N2O4 | 98.000 | Cc1ccc(cc1N1CCC(=O)NC1=O)C(O)=O | 50mg | 784552857
3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methylbenzoic acid | Synthonix | 2377643-37-1248.238 | C12H12N2O4 | 98.000 | Cc1ccc(cc1N1CCC(=O)NC1=O)C(O)=O | 50mg | 784552857
eMolecules 77-92-9 | Citric Acid, anhydrous granular, ACS | Oakwood Chemicals192.123 | C6H8O7 | 99.000 | OC(=O)CC(O)(CC(O)=O)C(O)=O | 2.5kg | 480153439
Citric Acid, anhydrous granular, ACS | Oakwood Chemicals | 77-92-9192.123 | C6H8O7 | 99.000 | OC(=O)CC(O)(CC(O)=O)C(O)=O | 2.5kg | 480153439
eMolecules 77-92-9 | Citric acid, anhydrous | Chem-Impex192.123 | C6H8O7 | 99.000 | OC(=O)CC(O)(CC(O)=O)C(O)=O | 2.5kg | 288407319
Citric acid, anhydrous | Chem-Impex | 77-92-9192.123 | C6H8O7 | 99.000 | OC(=O)CC(O)(CC(O)=O)C(O)=O | 2.5kg | 288407319
eMolecules 2415226-90-1 | Medchem Express | Lignoceric acid-d9 | 1mg | 784543824 | HY-121883SS5 | 377.701 | C24H48O2
Ambeed | 246-Tris(4-methoxyphenyl)pyrylium tetrafluoroborate | 50mg | 599355287 | A973789 | 580-34-7 | MFCD00160229 | 486.270 | C26H23BF4O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 53381-05-8 | 2-ETHOXYCYCLOPROPANE-1-CARBOXYLIC ACID | AstaTech | MFCD11858184 | 130.143 | C6H10O3 | 95.000 | CCOC1CC1C(O)=O | 0.1g | 771348171
2-ETHOXYCYCLOPROPANE-1-CARBOXYLIC ACID | AstaTech | 53381-05-8 | MFCD11858184 | 130.143 | C6H10O3 | 95.000 | CCOC1CC1C(O)=O | 0.1g | 771348171
eMolecules 1113-38-8 | Ambeed | Ammonium oxalate | 100g | 552536627 | A114144 | MFCD00013308 | 124.096 | C2H8N2O4
ChemScene | Oxazole-4-carbothioamide | 100mg | 569146536 | CS-0130151 | 118802-31-6 | MFCD06738920 | 128.150 | C4H4N2OS
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 479413-70-2 | Ambeed | 12-(3-(Adamantan-1-yl)ureido)dodecanoic acid | 1mg | 625593430 | A1148766 | 392.584 | C23H40N2O3
Ambeed | 2-(3-Fluorophenoxy)-5-(4455-tetramethyl-132-dioxaborolan-2-yl)pyridine | 250mg | 722704528 | A1670581 | | 315.150 | C17H19BFNO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Crescent Chemical Co Inc CITRIC ACID-H2O ANALYTICAL GRD
Citric acid-H2O analytical grade Buffer Substance. Size - 500G Storage Conditions - +15 °C TO +30 °C Catalog Number - 38640.01 CAS 5949-29-1
eMolecules 1070-83-3 | 3,3-Dimethylbutyric acid | Ambeed | MFCD00002715 | 116.160 | C6H12O2 | 98.000 | CC(C)(C)CC(O)=O | 10g | 552755356
3,3-Dimethylbutyric acid | Ambeed | 1070-83-3 | MFCD00002715 | 116.160 | C6H12O2 | 98.000 | CC(C)(C)CC(O)=O | 10g | 552755356
eMolecules 1730-91-2 | ChemScene | (S)-2-Methylbutanoic acid | 250mg | 572195006 | CS-0120626 | MFCD00063166 | 102.133 | C5H10O2
Ambeed | 2-(24-Dihydroxybenzoyl)benzoic acid | 100mg | 600831423 | A155090 | 2513-33-9 | MFCD00433869 | 258.229 | C14H10O5
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 77-92-9 | Citric Acid, anhydrous | Oakwood Chemical192.123 | C6H8O7 | 99.000 | OC(=O)CC(O)(CC(O)=O)C(O)=O | 3kg | 784545341
Citric Acid, anhydrous | Oakwood Chemical | 77-92-9192.123 | C6H8O7 | 99.000 | OC(=O)CC(O)(CC(O)=O)C(O)=O | 3kg | 784545341
eMolecules N-bis(Amine-PEG8)-N-(PEG8-acid), HCl salt | Broadpharm |1232.504 | C55H113N3O26 | 95.000 | NCCOCCOCCOCCOCCOCCOCCOCCOCCN(CCOCCOCCOCCOCCOCCOCCOCCOCCN)CCOCCOCCOCCOCCOCCOCCOCCOCCC(O)=O | 100mg | 784454978
N-bis(Amine-PEG8)-N-(PEG8-acid), HCl salt | Broadpharm |1232.504 | C55H113N3O26 | 95.000 | NCCOCCOCCOCCOCCOCCOCCOCCOCCN(CCOCCOCCOCCOCCOCCOCCOCCOCCN)CCOCCOCCOCCOCCOCCOCCOCCOCCC(O)=O | 100mg | 784454978
eMolecules 2230279-67-9 | 1-(6-((tert-butoxycarbonyl)amino)pyridin-2-yl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid | Synthonix372.304 | C15H15F3N4O4 | 94.000 | CC(C)(C)OC(=O)Nc1cccc(n1)-n1ncc(C(O)=O)c1C(F)(F)F | 50mg | 794076364
1-(6-((tert-butoxycarbonyl)amino)pyridin-2-yl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid | Synthonix | 2230279-67-9372.304 | C15H15F3N4O4 | 94.000 | CC(C)(C)OC(=O)Nc1cccc(n1)-n1ncc(C(O)=O)c1C(F)(F)F | 50mg | 794076364